C20H27N3O6S — CID 56558795
3-(cyclopentylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-4-methoxybenzamide (PubChem CID 56558795) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-4-methoxybenzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 56558795 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCN2C(=O)CCC2=O)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H27N3O6S/c1-29-16-8-7-14(13-17(16)30(27,28)22-15-5-2-3-6-15)20(26)21-11-4-12-23-18(24)9-10-19(23)25/h7-8,13,15,22H,2-6,9-12H2,1H3,(H,21,26) |
| InChIKey | GKWXQDDEYDUFJK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|