C17H25N3O4S — CID 119450739
3-(cyclopentylsulfamoyl)-4-methoxy-N-pyrrolidin-3-ylbenzamide (PubChem CID 119450739) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-4-methoxy-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119450739 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-pyrrolidin-3-ylbenzamide |
| SMILES | COc1ccc(C(=O)NC2CCNC2)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-24-15-7-6-12(17(21)19-14-8-9-18-11-14)10-16(15)25(22,23)20-13-4-2-3-5-13/h6-7,10,13-14,18,20H,2-5,8-9,11H2,1H3,(H,19,21) |
| InChIKey | RAPGHEHMJLKIKF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |