C12H18N2O4S — CID 79686260
2,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 79686260) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79686260 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@H]2CCNC2)c1 |
| InChI | InChI=1S/C12H18N2O4S/c1-17-10-3-4-11(18-2)12(7-10)19(15,16)14-9-5-6-13-8-9/h3-4,7,9,13-14H,5-6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | JKGPUMDTYQEQFP-VIFPVBQESA-N |
| XLogP | 0.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |