C12H17FN2O4S — CID 79686087
2-fluoro-4,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 79686087) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79686087 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)N[C@H]2CCNC2)cc1OC |
| InChI | InChI=1S/C12H17FN2O4S/c1-18-10-5-9(13)12(6-11(10)19-2)20(16,17)15-8-3-4-14-7-8/h5-6,8,14-15H,3-4,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | IQALPTYLJSQSNY-QMMMGPOBSA-N |
| XLogP | 0.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |