C12H16ClFN2O4S — CID 119967312
methyl 2-fluoro-6-(pyrrolidin-3-ylsulfamoyl)benzoate;hydrochloride (PubChem CID 119967312) has the molecular formula C12H16ClFN2O4S and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 2-fluoro-6-(pyrrolidin-3-ylsulfamoyl)benzoate;hydrochloride.
| Compound Name | methyl 2-fluoro-6-(pyrrolidin-3-ylsulfamoyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119967312 |
| Molecular Formula | C12H16ClFN2O4S |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | methyl 2-fluoro-6-(pyrrolidin-3-ylsulfamoyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)NC1CCNC1.Cl |
| InChI | InChI=1S/C12H15FN2O4S.ClH/c1-19-12(16)11-9(13)3-2-4-10(11)20(17,18)15-8-5-6-14-7-8;/h2-4,8,14-15H,5-7H2,1H3;1H |
| InChIKey | XUPXCCQEWXEPQG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |