C15H22ClFN2O4S — CID 119979747
methyl 2-fluoro-6-(2-piperidin-3-ylethylsulfamoyl)benzoate;hydrochloride (PubChem CID 119979747) has the molecular formula C15H22ClFN2O4S and a molecular weight of 380.87 g/mol. Its IUPAC name is methyl 2-fluoro-6-(2-piperidin-3-ylethylsulfamoyl)benzoate;hydrochloride.
| Compound Name | methyl 2-fluoro-6-(2-piperidin-3-ylethylsulfamoyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119979747 |
| Molecular Formula | C15H22ClFN2O4S |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | methyl 2-fluoro-6-(2-piperidin-3-ylethylsulfamoyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)NCCC1CCCNC1.Cl |
| InChI | InChI=1S/C15H21FN2O4S.ClH/c1-22-15(19)14-12(16)5-2-6-13(14)23(20,21)18-9-7-11-4-3-8-17-10-11;/h2,5-6,11,17-18H,3-4,7-10H2,1H3;1H |
| InChIKey | JNLSHKGRCMCUHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |