C14H22Cl2N2O2S — CID 119979704
4-chloro-2-methyl-N-(2-piperidin-3-ylethyl)benzenesulfonamide;hydrochloride (PubChem CID 119979704) has the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-(2-piperidin-3-ylethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-chloro-2-methyl-N-(2-piperidin-3-ylethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119979704 |
| Molecular Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-chloro-2-methyl-N-(2-piperidin-3-ylethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCCC1CCCNC1.Cl |
| InChI | InChI=1S/C14H21ClN2O2S.ClH/c1-11-9-13(15)4-5-14(11)20(18,19)17-8-6-12-3-2-7-16-10-12;/h4-5,9,12,16-17H,2-3,6-8,10H2,1H3;1H |
| InChIKey | JUNFAUASJUIZDR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |