C14H21ClN2O4S2 — CID 124690405
2-chloro-5-methylsulfonyl-N-[2-[(3R)-piperidin-3-yl]ethyl]benzenesulfonamide (PubChem CID 124690405) has the molecular formula C14H21ClN2O4S2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-chloro-5-methylsulfonyl-N-[2-[(3R)-piperidin-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-methylsulfonyl-N-[2-[(3R)-piperidin-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124690405 |
| Molecular Formula | C14H21ClN2O4S2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-chloro-5-methylsulfonyl-N-[2-[(3R)-piperidin-3-yl]ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)NCC[C@H]2CCCNC2)c1 |
| InChI | InChI=1S/C14H21ClN2O4S2/c1-22(18,19)12-4-5-13(15)14(9-12)23(20,21)17-8-6-11-3-2-7-16-10-11/h4-5,9,11,16-17H,2-3,6-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | FBKYKSQDURHLQO-LLVKDONJSA-N |
| XLogP | 1.41 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |