C13H17Cl2FN2O2S — CID 103088990
2,4-dichloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzenesulfonamide (PubChem CID 103088990) has the molecular formula C13H17Cl2FN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 2,4-dichloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088990 |
| Molecular Formula | C13H17Cl2FN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2,4-dichloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1CCCNC1)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H17Cl2FN2O2S/c14-10-3-4-11(12(15)13(10)16)21(19,20)18-7-5-9-2-1-6-17-8-9/h3-4,9,17-18H,1-2,5-8H2 |
| InChIKey | MMJXWWHSRFYIBF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|