C14H18ClF3N2O2S — CID 119979324
4-chloro-N-(2-piperidin-3-ylethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 119979324) has the molecular formula C14H18ClF3N2O2S and a molecular weight of 370.82 g/mol. Its IUPAC name is 4-chloro-N-(2-piperidin-3-ylethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-piperidin-3-ylethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119979324 |
| Molecular Formula | C14H18ClF3N2O2S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-chloro-N-(2-piperidin-3-ylethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1CCCNC1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2O2S/c15-13-4-3-11(8-12(13)14(16,17)18)23(21,22)20-7-5-10-2-1-6-19-9-10/h3-4,8,10,19-20H,1-2,5-7,9H2 |
| InChIKey | HDWIYOIOVKPWOJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |