C15H21FN2O4S — CID 119986529
methyl 2-[[2-(aminomethyl)cyclohexyl]sulfamoyl]-6-fluorobenzoate (PubChem CID 119986529) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 2-[[2-(aminomethyl)cyclohexyl]sulfamoyl]-6-fluorobenzoate.
| Compound Name | methyl 2-[[2-(aminomethyl)cyclohexyl]sulfamoyl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 119986529 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | methyl 2-[[2-(aminomethyl)cyclohexyl]sulfamoyl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1S(=O)(=O)NC1CCCCC1CN |
| InChI | InChI=1S/C15H21FN2O4S/c1-22-15(19)14-11(16)6-4-8-13(14)23(20,21)18-12-7-3-2-5-10(12)9-17/h4,6,8,10,12,18H,2-3,5,7,9,17H2,1H3 |
| InChIKey | QHJVVGQNAJXVIY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |