C12H18ClFN2O2S — CID 119985644
N-[2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide;hydrochloride (PubChem CID 119985644) has the molecular formula C12H18ClFN2O2S and a molecular weight of 308.81 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119985644 |
| Molecular Formula | C12H18ClFN2O2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C12H17FN2O2S.ClH/c13-10-5-1-2-7-12(10)18(16,17)15-11-6-3-4-9(11)8-14;/h1-2,5,7,9,11,15H,3-4,6,8,14H2;1H |
| InChIKey | MKSGCUWPNXWIJF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |