C11H13BrFNO2S — CID 80662243
N-(2-bromocyclopentyl)-2-fluorobenzenesulfonamide (PubChem CID 80662243) has the molecular formula C11H13BrFNO2S and a molecular weight of 322.20 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(2-bromocyclopentyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 80662243 |
| Molecular Formula | C11H13BrFNO2S |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | N-(2-bromocyclopentyl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1Br)c1ccccc1F |
| InChI | InChI=1S/C11H13BrFNO2S/c12-8-4-3-6-10(8)14-17(15,16)11-7-2-1-5-9(11)13/h1-2,5,7-8,10,14H,3-4,6H2 |
| InChIKey | GWIXXTBVUGKKMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|