C13H15F4NO2S — CID 60722057
2-fluoro-N-[2-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 60722057) has the molecular formula C13H15F4NO2S and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-fluoro-N-[2-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[2-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60722057 |
| Molecular Formula | C13H15F4NO2S |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-fluoro-N-[2-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C13H15F4NO2S/c14-10-6-2-4-8-12(10)21(19,20)18-11-7-3-1-5-9(11)13(15,16)17/h2,4,6,8-9,11,18H,1,3,5,7H2 |
| InChIKey | QTDXXWHWGLQIKZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |