C13H16F3NO3S — CID 104953174
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 104953174) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104953174 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3S/c14-13(15,16)9-5-1-4-8-12(9)21(19,20)17-10-6-2-3-7-11(10)18/h1,4-5,8,10-11,17-18H,2-3,6-7H2/t10-,11-/m0/s1 |
| InChIKey | RMJGXGAXSXMYCE-QWRGUYRKSA-N |
| XLogP | 2.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |