C16H19NO3S — CID 104922343
N-[(1R,2R)-2-hydroxycyclohexyl]naphthalene-1-sulfonamide (PubChem CID 104922343) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]naphthalene-1-sulfonamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 104922343 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCC[C@H]1O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NO3S/c18-15-10-4-3-9-14(15)17-21(19,20)16-11-5-7-12-6-1-2-8-13(12)16/h1-2,5-8,11,14-15,17-18H,3-4,9-10H2/t14-,15-/m1/s1 |
| InChIKey | NBFUYCKXNNOWJY-HUUCEWRRSA-N |
| XLogP | 2.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |