C12H16N2O5S — CID 101369255
N-[(1S,2S)-2-hydroxycyclohexyl]-2-nitrobenzenesulfonamide (PubChem CID 101369255) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101369255 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H16N2O5S/c15-11-7-3-1-5-9(11)13-20(18,19)12-8-4-2-6-10(12)14(16)17/h2,4,6,8-9,11,13,15H,1,3,5,7H2/t9-,11-/m0/s1 |
| InChIKey | ZNFYTOZEVJJZGI-ONGXEEELSA-N |
| XLogP | 1.18 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|