C13H17BrN2O4S — CID 106441017
N-(2-bromocyclohexyl)-2-methyl-3-nitrobenzenesulfonamide (PubChem CID 106441017) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-2-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(2-bromocyclohexyl)-2-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106441017 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-(2-bromocyclohexyl)-2-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)NC1CCCCC1Br |
| InChI | InChI=1S/C13H17BrN2O4S/c1-9-12(16(17)18)7-4-8-13(9)21(19,20)15-11-6-3-2-5-10(11)14/h4,7-8,10-11,15H,2-3,5-6H2,1H3 |
| InChIKey | IOXNJKJYIXWOSU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|