C12H18ClN3O4S — CID 120716604
2-methyl-3-nitro-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride (PubChem CID 120716604) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-methyl-3-nitro-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716604 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-methyl-3-nitro-N-[(3S)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)N[C@H]1CCCNC1.Cl |
| InChI | InChI=1S/C12H17N3O4S.ClH/c1-9-11(15(16)17)5-2-6-12(9)20(18,19)14-10-4-3-7-13-8-10;/h2,5-6,10,13-14H,3-4,7-8H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | YYLJDBULDZDJAD-PPHPATTJSA-N |
| XLogP | 1.36 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|