C11H14FN3O4S — CID 63321601
4-fluoro-2-nitro-N-piperidin-3-ylbenzenesulfonamide (PubChem CID 63321601) has the molecular formula C11H14FN3O4S and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-piperidin-3-ylbenzenesulfonamide.
| Compound Name | 4-fluoro-2-nitro-N-piperidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 63321601 |
| Molecular Formula | C11H14FN3O4S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-fluoro-2-nitro-N-piperidin-3-ylbenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(F)ccc1S(=O)(=O)NC1CCCNC1 |
| InChI | InChI=1S/C11H14FN3O4S/c12-8-3-4-11(10(6-8)15(16)17)20(18,19)14-9-2-1-5-13-7-9/h3-4,6,9,13-14H,1-2,5,7H2 |
| InChIKey | HPMQNZCJIKQDBF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|