C11H14FN3O5S — CID 43597115
4-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]-2-nitrobenzenesulfonamide (PubChem CID 43597115) has the molecular formula C11H14FN3O5S and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]-2-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43597115 |
| Molecular Formula | C11H14FN3O5S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]-2-nitrobenzenesulfonamide |
| SMILES | CO[C@H]1CNCC1NS(=O)(=O)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14FN3O5S/c1-20-10-6-13-5-8(10)14-21(18,19)11-3-2-7(12)4-9(11)15(16)17/h2-4,8,10,13-14H,5-6H2,1H3/t8?,10-/m0/s1 |
| InChIKey | JGXQWBRHQQTFQS-HTLJXXAVSA-N |
| XLogP | -0.00 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|