C11H14BrFN2O3S — CID 104889684
4-bromo-2-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]benzenesulfonamide (PubChem CID 104889684) has the molecular formula C11H14BrFN2O3S and a molecular weight of 353.21 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 104889684 |
| Molecular Formula | C11H14BrFN2O3S |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 4-bromo-2-fluoro-N-[(4S)-4-methoxypyrrolidin-3-yl]benzenesulfonamide |
| SMILES | CO[C@H]1CNCC1NS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H14BrFN2O3S/c1-18-10-6-14-5-9(10)15-19(16,17)11-3-2-7(12)4-8(11)13/h2-4,9-10,14-15H,5-6H2,1H3/t9?,10-/m0/s1 |
| InChIKey | HJNAUYVIGHIEEM-AXDSSHIGSA-N |
| XLogP | 0.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |