C10H12F2N2O2S — CID 79684830
2,4-difluoro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 79684830) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 2,4-difluoro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 79684830 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2,4-difluoro-N-[(3R)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCNC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O2S/c11-7-1-2-10(9(12)5-7)17(15,16)14-8-3-4-13-6-8/h1-2,5,8,13-14H,3-4,6H2/t8-/m1/s1 |
| InChIKey | FLBNZAVDJSDXQW-MRVPVSSYSA-N |
| XLogP | 0.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |