C11H12ClF3N2O2S — CID 62380630
4-chloro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 62380630) has the molecular formula C11H12ClF3N2O2S and a molecular weight of 328.74 g/mol. Its IUPAC name is 4-chloro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62380630 |
| Molecular Formula | C11H12ClF3N2O2S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 4-chloro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCNC1)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2O2S/c12-7-1-2-10(9(5-7)11(13,14)15)20(18,19)17-8-3-4-16-6-8/h1-2,5,8,16-17H,3-4,6H2 |
| InChIKey | QZAHAJXUNQMERU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |