C14H14ClF6NO2S — CID 24651399
4-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 24651399) has the molecular formula C14H14ClF6NO2S and a molecular weight of 409.78 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24651399 |
| Molecular Formula | C14H14ClF6NO2S |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCC(C(F)(F)F)CC1)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H14ClF6NO2S/c15-9-3-6-12(11(7-9)14(19,20)21)25(23,24)22-10-4-1-8(2-5-10)13(16,17)18/h3,6-8,10,22H,1-2,4-5H2 |
| InChIKey | YAJJSUJDBITNIJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |