C7H6ClF3N2O2S — CID 43476927
4-chloro-2-(trifluoromethyl)benzenesulfonohydrazide (PubChem CID 43476927) has the molecular formula C7H6ClF3N2O2S and a molecular weight of 274.65 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)benzenesulfonohydrazide.
| Compound Name | 4-chloro-2-(trifluoromethyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 43476927 |
| Molecular Formula | C7H6ClF3N2O2S |
| Molecular Weight | 274.65 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)benzenesulfonohydrazide |
| SMILES | NNS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C7H6ClF3N2O2S/c8-4-1-2-6(16(14,15)13-12)5(3-4)7(9,10)11/h1-3,13H,12H2 |
| InChIKey | JAAGBKMDIXBTON-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|