C11H13ClF3NO3S — CID 103918517
4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 103918517) has the molecular formula C11H13ClF3NO3S and a molecular weight of 331.74 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103918517 |
| Molecular Formula | C11H13ClF3NO3S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO3S/c1-2-8(6-17)16-20(18,19)10-4-3-7(12)5-9(10)11(13,14)15/h3-5,8,16-17H,2,6H2,1H3/t8-/m1/s1 |
| InChIKey | QATMESOKMPUHSG-MRVPVSSYSA-N |
| XLogP | 2.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |