C11H16FNO3S — CID 93084017
4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-2-methylbenzenesulfonamide (PubChem CID 93084017) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-2-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 93084017 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-2-methylbenzenesulfonamide |
| SMILES | CC[C@@H](CO)NS(=O)(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C11H16FNO3S/c1-3-10(7-14)13-17(15,16)11-5-4-9(12)6-8(11)2/h4-6,10,13-14H,3,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZAMSPCCWBMYZNN-JTQLQIEISA-N |
| XLogP | 1.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |