C11H15Br2NO3S — CID 104981937
2,5-dibromo-N-[(2S)-1-hydroxybutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 104981937) has the molecular formula C11H15Br2NO3S and a molecular weight of 401.12 g/mol. Its IUPAC name is 2,5-dibromo-N-[(2S)-1-hydroxybutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[(2S)-1-hydroxybutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104981937 |
| Molecular Formula | C11H15Br2NO3S |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 2,5-dibromo-N-[(2S)-1-hydroxybutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@H](CO)NS(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C11H15Br2NO3S/c1-3-8(6-15)14-18(16,17)11-5-9(12)7(2)4-10(11)13/h4-5,8,14-15H,3,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | LWDJHAJBMVUKBL-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |