C12H16Br2N2O2S2 — CID 81327479
3-[(2,5-dibromo-4-methylphenyl)sulfonylamino]pentanethioamide (PubChem CID 81327479) has the molecular formula C12H16Br2N2O2S2 and a molecular weight of 444.21 g/mol. Its IUPAC name is 3-[(2,5-dibromo-4-methylphenyl)sulfonylamino]pentanethioamide.
| Compound Name | 3-[(2,5-dibromo-4-methylphenyl)sulfonylamino]pentanethioamide |
|---|---|
| PubChem CID | 81327479 |
| Molecular Formula | C12H16Br2N2O2S2 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 3-[(2,5-dibromo-4-methylphenyl)sulfonylamino]pentanethioamide |
| SMILES | CCC(CC(N)=S)NS(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O2S2/c1-3-8(5-12(15)19)16-20(17,18)11-6-9(13)7(2)4-10(11)14/h4,6,8,16H,3,5H2,1-2H3,(H2,15,19) |
| InChIKey | SXNLZYRMOBDNTJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|