C12H15F3N2O2S2 — CID 62652720
3-[[2-(trifluoromethyl)phenyl]sulfonylamino]pentanethioamide (PubChem CID 62652720) has the molecular formula C12H15F3N2O2S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]pentanethioamide.
| Compound Name | 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]pentanethioamide |
|---|---|
| PubChem CID | 62652720 |
| Molecular Formula | C12H15F3N2O2S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]pentanethioamide |
| SMILES | CCC(CC(N)=S)NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2S2/c1-2-8(7-11(16)20)17-21(18,19)10-6-4-3-5-9(10)12(13,14)15/h3-6,8,17H,2,7H2,1H3,(H2,16,20) |
| InChIKey | FOUODRBXCLVXPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|