C11H13F3N2O2S2 — CID 62668032
2-methyl-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanethioamide (PubChem CID 62668032) has the molecular formula C11H13F3N2O2S2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-methyl-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanethioamide.
| Compound Name | 2-methyl-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 62668032 |
| Molecular Formula | C11H13F3N2O2S2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-methyl-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanethioamide |
| SMILES | CC(CNS(=O)(=O)c1ccccc1C(F)(F)F)C(N)=S |
| InChI | InChI=1S/C11H13F3N2O2S2/c1-7(10(15)19)6-16-20(17,18)9-5-3-2-4-8(9)11(12,13)14/h2-5,7,16H,6H2,1H3,(H2,15,19) |
| InChIKey | WPSPEWAFBQWTDT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|