C12H17F3N2O3S — CID 104593954
N-[2-(2-hydroxypropylamino)ethyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 104593954) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104593954 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(O)CNCCNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O3S/c1-9(18)8-16-6-7-17-21(19,20)11-5-3-2-4-10(11)12(13,14)15/h2-5,9,16-18H,6-8H2,1H3 |
| InChIKey | USNVLMWWTVVOQM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|