C12H16F3NO3S — CID 115754908
N-(2-hydroxy-3-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 115754908) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(2-hydroxy-3-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-hydroxy-3-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115754908 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(2-hydroxy-3-methylbutyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)C(O)CNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3S/c1-8(2)10(17)7-16-20(18,19)11-6-4-3-5-9(11)12(13,14)15/h3-6,8,10,16-17H,7H2,1-2H3 |
| InChIKey | OICZZJSUTQKWSU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |