C10H9F3NO4S- — CID 6922915
(2S)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 6922915) has the molecular formula C10H9F3NO4S- and a molecular weight of 296.25 g/mol. Its IUPAC name is (2S)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | (2S)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 6922915 |
| Molecular Formula | C10H9F3NO4S- |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (2S)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C10H10F3NO4S/c1-6(9(15)16)14-19(17,18)8-5-3-2-4-7(8)10(11,12)13/h2-6,14H,1H3,(H,15,16)/p-1/t6-/m0/s1 |
| InChIKey | ADMRLEYIFPXHND-LURJTMIESA-M |
| XLogP | 0.12 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |