C16H16F3N3O3S — CID 35026880
(2S)-N-(5-methyl-2-pyridinyl)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 35026880) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is (2S)-N-(5-methyl-2-pyridinyl)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | (2S)-N-(5-methyl-2-pyridinyl)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 35026880 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (2S)-N-(5-methyl-2-pyridinyl)-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)NS(=O)(=O)c2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H16F3N3O3S/c1-10-7-8-14(20-9-10)21-15(23)11(2)22-26(24,25)13-6-4-3-5-12(13)16(17,18)19/h3-9,11,22H,1-2H3,(H,20,21,23)/t11-/m0/s1 |
| InChIKey | MCXJURGATSHNGD-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |