C11H13Br2NO4S — CID 81327925
methyl 2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]propanoate (PubChem CID 81327925) has the molecular formula C11H13Br2NO4S and a molecular weight of 415.10 g/mol. Its IUPAC name is methyl 2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 81327925 |
| Molecular Formula | C11H13Br2NO4S |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | methyl 2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)NS(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C11H13Br2NO4S/c1-6-4-9(13)10(5-8(6)12)19(16,17)14-7(2)11(15)18-3/h4-5,7,14H,1-3H3 |
| InChIKey | AVJZISFBIRPUHB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |