C10H12Br2N2O4S — CID 61496754
methyl 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]propanoate (PubChem CID 61496754) has the molecular formula C10H12Br2N2O4S and a molecular weight of 416.09 g/mol. Its IUPAC name is methyl 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 61496754 |
| Molecular Formula | C10H12Br2N2O4S |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | methyl 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)NS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C10H12Br2N2O4S/c1-5(10(15)18-2)14-19(16,17)9-7(11)3-6(13)4-8(9)12/h3-5,14H,13H2,1-2H3 |
| InChIKey | ZXTHKTMAMZOKFY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|