C13H16Br2N2O2S — CID 61479282
4-amino-2,6-dibromo-N-(dicyclopropylmethyl)benzenesulfonamide (PubChem CID 61479282) has the molecular formula C13H16Br2N2O2S and a molecular weight of 424.16 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-(dicyclopropylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-(dicyclopropylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61479282 |
| Molecular Formula | C13H16Br2N2O2S |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 4-amino-2,6-dibromo-N-(dicyclopropylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)c(S(=O)(=O)NC(C2CC2)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C13H16Br2N2O2S/c14-10-5-9(16)6-11(15)13(10)20(18,19)17-12(7-1-2-7)8-3-4-8/h5-8,12,17H,1-4,16H2 |
| InChIKey | TUPOGEMLSBUVJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|