C14H20Br2N2O2S — CID 64733233
4-amino-2,6-dibromo-N-(3,5-dimethylcyclohexyl)benzenesulfonamide (PubChem CID 64733233) has the molecular formula C14H20Br2N2O2S and a molecular weight of 440.20 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-(3,5-dimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-(3,5-dimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64733233 |
| Molecular Formula | C14H20Br2N2O2S |
| Molecular Weight | 440.20 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | 4-amino-2,6-dibromo-N-(3,5-dimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CC(C)CC(NS(=O)(=O)c2c(Br)cc(N)cc2Br)C1 |
| InChI | InChI=1S/C14H20Br2N2O2S/c1-8-3-9(2)5-11(4-8)18-21(19,20)14-12(15)6-10(17)7-13(14)16/h6-9,11,18H,3-5,17H2,1-2H3 |
| InChIKey | VTFPGHPMLVUWEI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|