C13H21Br2N3O2S — CID 61476435
4-amino-2,6-dibromo-N-[1-(dimethylamino)-3-methylbutan-2-yl]benzenesulfonamide (PubChem CID 61476435) has the molecular formula C13H21Br2N3O2S and a molecular weight of 443.21 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-[1-(dimethylamino)-3-methylbutan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-[1-(dimethylamino)-3-methylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 61476435 |
| Molecular Formula | C13H21Br2N3O2S |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 4-amino-2,6-dibromo-N-[1-(dimethylamino)-3-methylbutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)C(CN(C)C)NS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C13H21Br2N3O2S/c1-8(2)12(7-18(3)4)17-21(19,20)13-10(14)5-9(16)6-11(13)15/h5-6,8,12,17H,7,16H2,1-4H3 |
| InChIKey | HSGUTKXJRQSSKZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|