C10H10BrF2NO4S — CID 61141689
methyl (2S)-2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoate (PubChem CID 61141689) has the molecular formula C10H10BrF2NO4S and a molecular weight of 358.16 g/mol. Its IUPAC name is methyl (2S)-2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 61141689 |
| Molecular Formula | C10H10BrF2NO4S |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | methyl (2S)-2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H10BrF2NO4S/c1-5(10(15)18-2)14-19(16,17)9-7(11)3-6(12)4-8(9)13/h3-5,14H,1-2H3/t5-/m0/s1 |
| InChIKey | RGGGQOLTIGVKFH-YFKPBYRVSA-N |
| XLogP | 1.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |