C10H11F2NO4S — CID 113257628
methyl (2R)-2-[(2,6-difluorophenyl)sulfonylamino]propanoate (PubChem CID 113257628) has the molecular formula C10H11F2NO4S and a molecular weight of 279.26 g/mol. Its IUPAC name is methyl (2R)-2-[(2,6-difluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R)-2-[(2,6-difluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 113257628 |
| Molecular Formula | C10H11F2NO4S |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | methyl (2R)-2-[(2,6-difluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2NO4S/c1-6(10(14)17-2)13-18(15,16)9-7(11)4-3-5-8(9)12/h3-6,13H,1-2H3/t6-/m1/s1 |
| InChIKey | CVDYUDZWRJKAFE-ZCFIWIBFSA-N |
| XLogP | 0.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |