C11H13F2NO2S — CID 8817126
N-[(1R)-1-cyclopropylethyl]-2,6-difluorobenzenesulfonamide (PubChem CID 8817126) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8817126 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-2,6-difluorobenzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1c(F)cccc1F)C1CC1 |
| InChI | InChI=1S/C11H13F2NO2S/c1-7(8-5-6-8)14-17(15,16)11-9(12)3-2-4-10(11)13/h2-4,7-8,14H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | LVUUWONPJVRCCK-SSDOTTSWSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |