C12H15F3N2O2S — CID 103976987
2,4,6-trifluoro-N-(1-pyrrolidin-3-ylethyl)benzenesulfonamide (PubChem CID 103976987) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(1-pyrrolidin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2,4,6-trifluoro-N-(1-pyrrolidin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103976987 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,4,6-trifluoro-N-(1-pyrrolidin-3-ylethyl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1c(F)cc(F)cc1F)C1CCNC1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-7(8-2-3-16-6-8)17-20(18,19)12-10(14)4-9(13)5-11(12)15/h4-5,7-8,16-17H,2-3,6H2,1H3 |
| InChIKey | KZWFPFPNEFSOLH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |