C11H13F3N2O2S — CID 54881709
2,4,6-trifluoro-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 54881709) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 2,4,6-trifluoro-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 54881709 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2,4,6-trifluoro-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCNCC1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H13F3N2O2S/c12-7-5-9(13)11(10(14)6-7)19(17,18)16-8-1-3-15-4-2-8/h5-6,8,15-16H,1-4H2 |
| InChIKey | BVECINROHPZTRG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |