C13H17BrF2N2O2S — CID 79117967
2-bromo-4,6-difluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide (PubChem CID 79117967) has the molecular formula C13H17BrF2N2O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79117967 |
| Molecular Formula | C13H17BrF2N2O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-[4-(methylamino)cyclohexyl]benzenesulfonamide |
| SMILES | CNC1CCC(NS(=O)(=O)c2c(F)cc(F)cc2Br)CC1 |
| InChI | InChI=1S/C13H17BrF2N2O2S/c1-17-9-2-4-10(5-3-9)18-21(19,20)13-11(14)6-8(15)7-12(13)16/h6-7,9-10,17-18H,2-5H2,1H3 |
| InChIKey | HZWGOBVPJGWGGL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |