C6H2BrF3O2S — CID 99939039
2-bromo-4,6-difluorobenzenesulfonyl fluoride (PubChem CID 99939039) has the molecular formula C6H2BrF3O2S and a molecular weight of 275.04 g/mol. Its IUPAC name is 2-bromo-4,6-difluorobenzenesulfonyl fluoride.
| Compound Name | 2-bromo-4,6-difluorobenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 99939039 |
| Molecular Formula | C6H2BrF3O2S |
| Molecular Weight | 275.04 g/mol |
| Exact Mass | 273.89 |
| IUPAC Name | 2-bromo-4,6-difluorobenzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C6H2BrF3O2S/c7-4-1-3(8)2-5(9)6(4)13(10,11)12/h1-2H |
| InChIKey | UYQJPKWCZMLUNP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.04 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |