C12H6Br3F2NO2S — CID 60640704
2-bromo-N-(2,4-dibromophenyl)-4,6-difluorobenzenesulfonamide (PubChem CID 60640704) has the molecular formula C12H6Br3F2NO2S and a molecular weight of 505.96 g/mol. Its IUPAC name is 2-bromo-N-(2,4-dibromophenyl)-4,6-difluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-(2,4-dibromophenyl)-4,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60640704 |
| Molecular Formula | C12H6Br3F2NO2S |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 502.76 |
| IUPAC Name | 2-bromo-N-(2,4-dibromophenyl)-4,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)cc1Br)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H6Br3F2NO2S/c13-6-1-2-11(8(14)3-6)18-21(19,20)12-9(15)4-7(16)5-10(12)17/h1-5,18H |
| InChIKey | UAYFBWJRUVEZBC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |