C11H6BrF3N2O2S — CID 103775763
2-bromo-4,6-difluoro-N-(6-fluoro-3-pyridinyl)benzenesulfonamide (PubChem CID 103775763) has the molecular formula C11H6BrF3N2O2S and a molecular weight of 367.15 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(6-fluoro-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-(6-fluoro-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103775763 |
| Molecular Formula | C11H6BrF3N2O2S |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(6-fluoro-3-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)nc1)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H6BrF3N2O2S/c12-8-3-6(13)4-9(14)11(8)20(18,19)17-7-1-2-10(15)16-5-7/h1-5,17H |
| InChIKey | NYFLPBROEYQGEU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|